On Target AOFA_HUMAN 0.15384616/CHEMBL3330334
For the given ligand SMZ, we have found in our database that, being scored 0.15384616, the most similar ligand is CHEMBL3330334. Check out the elaboration below.
| SMZ (Given Ligand) | CHEMBL3330334 (Similar Ligand) |
|---|---|
| C1CC2CCCC3CCCC(C1)C23 | Cl.N[C@]1(CCc2ccccc2)C[C@H]1c3ccccc3 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00000000 01000200 00000102 00010600 00000000 00000000 00000000 00000000 00000800 000808c0 08100000 40008000 00000000 01200000 00000000 00000000 00000000 02000000 00002000 00000001 00000100 18000000 00000000 81400010 00000000 80000000 00000000 00000000 04000002 0006000a 00020000 00020400 |