On Target NK1R_HUMAN 0.104477614/CHEMBL49175
For the given ligand SMZ, we have found in our database that, being scored 0.104477614, the most similar ligand is CHEMBL49175. Check out the elaboration below.
| SMZ (Given Ligand) | CHEMBL49175 (Similar Ligand) |
|---|---|
| C1CC2CCCC3CCCC(C1)C23 | Fc1ccc(cc1)C2CCN(CC2)C3CCC(CCCc4cc(cc(c4)C(F)(F)F)C(F)(F)F)(CC3)c5ccccc5 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00000000 01090200 00100102 02010600 00000001 00000010 00000400 20000000 00100800 000808d0 08300000 50018002 00000002 01201000 00000000 000c0008 00000000 02000080 02002000 00100201 00000100 18000010 01000000 00500010 00000000 80000000 00000000 90000001 00000002 0006800a 00120000 00002600 |