On Target TRPV1_RAT 0.094339624/CHEMBL15848
For the given ligand SMZ, we have found in our database that, being scored 0.094339624, the most similar ligand is CHEMBL15848. Check out the elaboration below.
| SMZ (Given Ligand) | CHEMBL15848 (Similar Ligand) |
|---|---|
| C1CC2CCCC3CCCC(C1)C23 | CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)NCCO |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00010002 01004000 00100000 00000400 00000080 00000000 00000000 20000402 00000000 00108080 00200000 40011000 04028002 00000000 00080400 00080008 10000000 00000000 00012000 00020201 00000001 10000600 02008000 00100818 00200000 00000000 00404000 90000000 00000000 00040001 24000000 00000200 |