On Target HYES_HUMAN 0.21212122/CHEMBL69663
For the given ligand SMZ, we have found in our database that, being scored 0.21212122, the most similar ligand is CHEMBL69663. Check out the elaboration below.
| SMZ (Given Ligand) | CHEMBL69663 (Similar Ligand) |
|---|---|
| C1CC2CCCC3CCCC(C1)C23 | CCCCCCCCCCNC(=O)NC12CC3CC(CC(C3)C1)C2 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00000000 01001000 00100000 00000c00 00000000 00000000 00000004 00002000 00000000 00000080 00200000 40010000 00009000 00000000 00000000 00000000 00000000 00000000 02002040 00000001 00000100 10050410 00000000 00100018 00010000 00000000 00000000 10000000 00000000 00040001 000a0000 00000200 |