On Target TRPV3_HUMAN 0.06481481/CHEMBL3696381
For the given ligand SMZ, we have found in our database that, being scored 0.06481481, the most similar ligand is CHEMBL3696381. Check out the elaboration below.
| SMZ (Given Ligand) | CHEMBL3696381 (Similar Ligand) |
|---|---|
| C1CC2CCCC3CCCC(C1)C23 | CC(C)[C@H](CO)NCc1nc(ccc1F)C2CCC(CC2)C(C)(C)C |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 0000009a 01000000 00104102 16000e00 000400a1 00100022 01000000 02003001 00000800 00080040 08318004 40800000 00000802 00201000 00020400 020c010d 12008200 060020a2 02602008 00100241 40100100 18018000 23800000 20400010 00100000 c0000000 00000040 80001081 00000106 00860002 20060880 20004600 |