On Target NTRK1_HUMAN 0.06741573/CHEMBL1982413
For the given ligand SMZ, we have found in our database that, being scored 0.06741573, the most similar ligand is CHEMBL1982413. Check out the elaboration below.
| SMZ (Given Ligand) | CHEMBL1982413 (Similar Ligand) |
|---|---|
| C1CC2CCCC3CCCC(C1)C23 | CN(Cc1cc(Cl)c(O)c2ncccc12)C3CCCCC3 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00018002 09000808 60104100 00010600 000c0000 00000004 06000000 22201000 00000000 000008c8 00200004 40018800 82000806 00400000 80000440 0004000c 00000008 02000000 02202000 00020201 40000000 18008118 20800000 80500010 00006400 c0000800 00220040 90000000 00000100 00060000 20048000 00420220 |