On Target BACE1_HUMAN 0.175/CHEMBL3586197
For the given ligand SMZ, we have found in our database that, being scored 0.175, the most similar ligand is CHEMBL3586197. Check out the elaboration below.
| SMZ (Given Ligand) | CHEMBL3586197 (Similar Ligand) |
|---|---|
| C1CC2CCCC3CCCC(C1)C23 | CC1(C)[C@H](O)CC[C@]2(C)[C@H]3CC[C@H]4[C@@](C)(CC[C@H]5C(C)(C)C(=O)CC[C@]45C)CC3=CC(=O)[C@@H]12 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00050000 01000000 00000000 00000000 00080000 00000000 00000080 00000402 01000000 00108008 00000000 40001000 04028008 00800000 00000400 00080008 00000000 00000020 02412000 00000001 00000000 00000280 01008000 00000010 00200000 00000000 00404000 80001000 00000000 00000000 24020000 00000000 |