On Target OPRM_MOUSE 0.09859155/CHEMBL592
For the given ligand SMZ, we have found in our database that, being scored 0.09859155, the most similar ligand is CHEMBL592. Check out the elaboration below.
| SMZ (Given Ligand) | CHEMBL592 (Similar Ligand) |
|---|---|
| C1CC2CCCC3CCCC(C1)C23 | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc4ccc(O)cc34 |
|
|
|
|
|
|
| 00000000 01000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 02002000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00020000 00000000 | 00000000 43000208 20100102 00010600 00000020 40000002 02000000 20000001 00000880 000808c0 08300000 50818000 00000002 00200000 00000020 02040008 00000200 02000000 02002000 00020201 00000100 18200010 00004000 81500010 00000000 80000001 00120000 10000000 04000002 0006000a 00020000 00002600 |