On Target BACE1_HUMAN 0.35643566/CHEMBL3586198
For the given ligand Aspirin, we have found in our database that, being scored 0.35643566, the most similar ligand is CHEMBL3586198. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL3586198 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | COc1ccc(cc1O)C(=O)O[C@H]2CC[C@]3(C)[C@H]4CC[C@@H]5[C@@]6(C)CC[C@@H](O)C(C)(C)[C@@H]6C[C@H](O)[C@@]5(O)C[C@]4(C)CC[C@H]3[C@@]2(C)C(=O)O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 00010000 49000808 20000109 00010300 000c1050 00204000 02040000 00000000 00000100 01000848 00000000 40009000 1400c00a 02810000 01000001 22089008 00820000 02000000 03402000 00020201 00000020 08020a20 05000000 00400014 00000400 80002000 004a8000 00001000 00000200 0002000a c0020000 02000000 |