On Target NMDE2_HUMAN 0.32142857/CHEMBL161421
For the given ligand Aspirin, we have found in our database that, being scored 0.32142857, the most similar ligand is CHEMBL161421. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL161421 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | FC(F)(F)Oc1ccc(cc1)C(=N)NCc2ccccc2 |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 00000000 00000008 20100108 00010600 00001010 00000000 02040000 02001000 00000100 00000853 00200000 40408000 00000802 00000000 01000401 00180008 00002000 02000000 00000000 00020000 00000000 08008000 0000000a 00400000 00000000 c0000000 40220000 d0000000 02000318 00060000 40040000 00000200 |