On Target NMDZ1_HUMAN 0/CHEMBL399519
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL399519. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL399519 (Similar Ligand) |
|---|---|
| C | CCS(=O)(=O)N(CCC(F)(F)F)c1c(Cl)c(Cl)cc2NC(=O)C(=O)Nc12 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0001c022 04008004 0010000e 01300620 a00c0040 08800010 08008226 08401000 06000200 00400860 0c202404 40008800 02108c0c 00440001 809e0041 00060444 0c040000 08000400 08200000 01004008 40140081 1c048900 21800000 10310830 82006082 40104400 000084c0 902200ac 04008000 00460000 00040000 004322e0 |