On Target PERM_HUMAN 0/CHEMBL1630740
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1630740. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1630740 (Similar Ligand) |
|---|---|
| C | CN1CCN(CCCc2c[nH]c3ccc(F)cc23)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 00000a00 00100100 46810610 00041200 00000030 00002000 20000000 00400800 000808c0 08300004 40008000 08000802 00403800 00000040 00040005 00000000 02000080 00200400 00100201 40000100 38008008 20800021 82400010 00042000 80000000 08000000 10000001 08000000 0007800a 00040200 00000620 |