On Target ACES_HUMAN 0/CHEMBL87320
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL87320. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL87320 (Similar Ligand) |
|---|---|
| C | [Br-].COCC[N+]1(C)CCC(CCC(=O)c2cc3cc(OC)c(OC)cc3s2)CC1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010040 11000808 2010010a 00010600 00081080 00800000 020000a0 20000010 00000800 00c808c0 08300200 d0019080 0400c03a 02200000 01083081 00088008 11010000 02000028 00002000 00020205 00000900 580a0298 12000080 10500014 02000082 84000000 00000000 10000505 00000202 000e000a 88060008 00c10610 |