On Target TRPV1_RAT 0/CHEMBL215966
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL215966. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL215966 (Similar Ligand) |
|---|---|
| C | Fc1cc(ccc1C(=O)Nc2ccc(cc2)C(F)(F)F)c3ncccc3C(F)(F)F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00006002 00000801 00104100 52010610 00041020 10000010 00000c00 02081000 02000100 10002850 00288004 5000c000 80018840 03309000 20020040 02040004 02060220 02002004 0c200000 14400000 44100000 08028600 30812000 20400024 00040002 80000000 08002240 900000c1 0040c104 00068401 80140800 00000200 |