On Target PAR1_HUMAN 0/CHEMBL63966
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL63966. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL63966 (Similar Ligand) |
|---|---|
| C | NCCCC[C@H](NC(=O)[C@H](Cc1ccc(F)c(F)c1)NC(=O)Nc2ccc3c(CN4CCCC4)cn(Cc5c(Cl)cccc5Cl)c3c2)C(=O)NCc6ccccc6 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 10018006 01803a00 00100100 06010e10 00041000 00000030 0000c004 2200300d 00100800 000b28c0 09380004 5001b800 0600b82e 00503401 800004c0 00040004 00061818 82c00080 08202008 00100201 c0000900 38258f38 20826007 83500038 00156800 c0000200 88008080 90000081 0c708100 0006800b 200cc200 80026660 |