On Target SC6A4_HUMAN 0/CHEMBL247265
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL247265. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL247265 (Similar Ligand) |
|---|---|
| C | CCN(CC)CCCOc1cc2CNCC(c3ccc(Cl)c(Cl)c3)c2cn1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0c00800a 44004818 20104109 11010610 80041020 02010100 04042400 01005000 00410280 00090844 08240004 40008800 828008a6 00200080 a1000501 001c208c 10210008 02000024 00a80400 00020200 40020040 18208500 21804080 914c8010 00046001 e0100000 08160000 c0002000 07400380 00060002 a0008000 04020660 |