On Target MK01_HUMAN 0/CHEMBL388978
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL388978. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL388978 (Similar Ligand) |
|---|---|
| C | CN[C@@H]1C[C@H]2O[C@@](C)([C@@H]1OC)n3c4ccccc4c5c6CNC(=O)c6c7c8ccccc8n2c7c35 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000002 01c09800 00100100 90010700 803c00c0 00008000 00008c01 82001044 00202000 000009d0 00200004 40018012 80008802 01ec0100 000414c0 001cd00c 08b02028 02800004 18e03000 00000001 c0080020 180686b8 37800080 8c50001c 10004400 c0200002 00008240 90000070 00400301 00060051 803d8200 00000220 |