On Target TRPV3_HUMAN 0/CHEMBL3984832
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL3984832. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL3984832 (Similar Ligand) |
|---|---|
| C | COc1cccc2CCCN(C(=O)CSc3ncccc3Cl)c12 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000c002 43201208 20124168 08112601 a0051000 c0002040 02000100 20000000 00060800 020a4cc0 08780024 60008800 0600880b 20140000 01020041 0004440c 04048000 02000000 08280028 00020201 c0100100 1a048700 20902000 04488039 00000800 91080200 20004050 110010c0 00288200 0006004b 10000480 22230660 |