On Target AMPN_HUMAN 0/CHEMBL1077585
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1077585. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1077585 (Similar Ligand) |
|---|---|
| C | CCCC[C@@H](N)CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@H]2Cc3c(CN(CC(=O)N[C@@H](Cc4ccccc4)C(=O)O)C2=O)[nH]c5ccccc35 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0001800a 0180fe08 20100100 55810e10 000412a0 00100000 03002000 2200300d 00400880 000909c0 08310004 4001b000 1e00888a 0060a801 801204c0 020c010c 10000200 02000006 00602408 00020a01 c0020100 38278e18 23804043 93500018 00143880 c0000001 08124000 90000000 0c000104 0186001b 20064200 00006620 |