On Target PPARG_HUMAN 0/CHEMBL248530
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL248530. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL248530 (Similar Ligand) |
|---|---|
| C | CCCCCCCN(CC(=O)O)Cc1ccc(OCCc2nc(oc2C)c3ccccc3)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0440920b 01000018 20181108 10010610 000010c1 02004000 02040400 228c1140 00004100 180a18d0 00208001 6001a002 82818c02 00200000 810a0421 100c200c 10008020 02002800 00003200 40c28201 05240000 18108a38 23004000 04500010 00040000 e0004000 04220008 98001000 80000305 00260800 60464800 20000200 |