On Target CASP1_HUMAN 0/CHEMBL1221503
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1221503. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1221503 (Similar Ligand) |
|---|---|
| C | COc1ccc(CCCNC(=O)C[C@@H](C(C)C)C(=O)N[C@@H](CC(=O)O)C=O)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00070000 01001208 20100108 00010600 00001000 00000000 02040000 20000000 00200800 000808c0 08300000 4003b000 0e008002 00000000 81000001 000c0008 00000000 02000001 00c00010 00020201 00000100 18140e00 01000080 00500018 00001001 80000000 00120000 10000000 00000202 0006000b 20004000 00802600 |