On Target CHLE_HUMAN 0/CHEMBL334395
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL334395. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL334395 (Similar Ligand) |
|---|---|
| C | CCCSc1nc(nn1C(=O)N(C)C)c2ccc(Cl)cc2 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 01108004 01100108 c0000920 00118e00 01000080 00018014 00830300 30082000 00820108 000048c0 01200008 40008900 02018004 00040001 00020020 0108204c 04038000 02012000 80e80003 02200240 002c0000 08010580 33000080 00484030 22002000 80000001 15244000 00100061 08000105 00061001 80000a80 03030144 |