On Target PDE4B_HUMAN 0/CHEMBL1221434
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1221434. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1221434 (Similar Ligand) |
|---|---|
| C | CC(C)(O)CCc1ccc(OCc2cc(c3cccc(OC(F)F)c3)c4ncccc4c2)cc1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04002002 41000008 2010410a 00010210 00051011 04004008 02040000 00000000 00000900 00080840 08100004 40408000 00800802 00610000 01000041 820c000c 000200c0 02001004 04680000 40021201 40000100 08008068 31800048 80c01010 00040001 80082000 08120200 c0000041 02414200 00020002 40041004 00000600 |