On Target BACE1_HUMAN 0/CHEMBL1270934
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1270934. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1270934 (Similar Ligand) |
|---|---|
| C | CC#Cc1cccc(c1)[C@]2(N=C(N)N(C)C2=O)c3ccc(OC(F)F)cc3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000200 00020008 2010090a 00090e20 00403011 00000104 02260000 01003000 00000200 00080c42 18200010 4040b204 0100b802 00000008 41000001 00180008 00008808 02000000 00010000 00020000 00210000 38a18680 00008009 83400810 0000008c a0140000 48728000 c4004000 0e000290 00060003 00042000 00000600 |