On Target NEP_HUMAN 0/CHEMBL81232
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL81232. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL81232 (Similar Ligand) |
|---|---|
| C | OC(=O)CNC(=O)\C(=C/c1ccccc1)\CS |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000000 0000c000 00100100 00110600 00000080 00000000 80100080 00000400 01800000 00400840 00200800 c000b000 02008002 00050002 80080002 00080008 30000400 02000100 00018000 01c00200 40000000 18000e00 02000200 00400018 00000000 80000000 00482000 40010010 00400000 40060021 24004000 01010200 |