On Target HPGDS_HUMAN 0/CHEMBL3698261
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL3698261. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL3698261 (Similar Ligand) |
|---|---|
| C | CC1C=CC=C1C(=O)N2CCN(CC2)C(=O)NC3CCN(CC3)c4ccc(cc4)C(=O)N5CCCCC5 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00004002 0104bc00 00100100 84010e00 60000000 00002001 00100004 22003408 11000000 001209e0 00240004 50019000 0402b802 2001a000 00020640 00000004 20044010 02000100 080900c0 02001201 60100100 380f8600 60008021 0250081c 00010000 c0000000 00480000 90000080 0c008100 800e0011 a4140000 00000200 |