On Target ALDR_HUMAN 0/CHEMBL279274
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL279274. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL279274 (Similar Ligand) |
|---|---|
| C | C[S+]([O-])c1ccc(Cl)cc1C2NC(=O)NC2=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00008001 0d803200 00120100 00512e00 00080000 28200020 04000004 02003204 00000000 00080848 09200000 6000b800 1f009804 00008000 c0000200 00c40000 04004008 02002000 00000020 00000001 80020100 38218700 00800008 81480019 00002000 90000000 10028000 c0000000 0c000100 00070003 22046000 80030624 |