On Target PGH1_SHEEP 0/CHEMBL8968
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL8968. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL8968 (Similar Ligand) |
|---|---|
| C | Cc1ccccc1N2C(=O)c3ccccc3C2=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00004002 00800800 00000100 10010600 00000000 00008040 00000080 02001000 00000000 00000840 00280004 4000c000 00008802 00300000 00020440 00000000 00042000 02000000 08100000 00000000 c0120000 08028680 20012000 0044000c 00000000 c0200000 00000010 80001080 00008100 00060001 80040020 00000200 |