On Target NMDE2_HUMAN 0/CHEMBL247717
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL247717. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL247717 (Similar Ligand) |
|---|---|
| C | FC(F)(F)Oc1ccc(cc1)C2=NCC(N2)c3cccc(Cl)c3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00008040 0c040008 20300108 08010600 40001010 00000000 16050000 02001000 00000100 0009085b 18200010 40408800 02000807 0000a008 81040401 20180008 00002800 02000002 00000000 00020000 00200000 38008100 0000001a 83480012 00002080 c0000000 40220000 d0000000 0e200318 00068002 40040080 00020600 |