On Target MDR1_HUMAN 0/CHEMBL95119
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL95119. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL95119 (Similar Ligand) |
|---|---|
| C | COc1ccc(cc1)N2CCN(CC(O)COc3ccccc3C(=O)CCc4ccccc4)CC2 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04004002 01000808 2010012a 04010600 00001080 82020000 02000000 00000208 00000810 00080a40 08300004 40009060 04808022 00202000 01300041 000a2008 10240000 22008000 08800008 00020201 40100100 38020200 270000a1 0a400416 00000801 c0000000 00040800 00800080 08008300 00064002 80000000 00000640 |