On Target OPRM_MOUSE 0/CHEMBL294616
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL294616. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL294616 (Similar Ligand) |
|---|---|
| C | CC1(C)SSC(C)(C)[C@@H](NC(=O)[C@@H](N)Cc2ccc(O)cc2)C(=O)NCC(=O)N[C@H](Cc3ccccc3)C(=O)N[C@H]1C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000001 80007218 60100100 44110700 00000080 00000100 02000000 2000000c 00000880 020f08c0 08300000 4000b000 06008006 00042001 80180000 000c0008 10000000 02000000 00400008 004e2301 40000140 38200e00 03000603 87400018 00000800 80800000 00120400 50000000 0c000000 0006802b 20004000 03412600 |