On Target P2Y12_HUMAN 0/CHEMBL1784218
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1784218. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1784218 (Similar Ligand) |
|---|---|
| C | CCOC(=O)c1cc(C#N)c(nc1C(F)(F)F)N2CCN(CC2)C(=O)NCc3cccc(F)c3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00004002 00802800 001041a4 96490e10 01041030 0000c050 10100404 02003008 10200100 20832a70 05202004 50828800 0000a802 0121b000 00120920 1e1c000c 00664014 02004004 08a14040 40a00000 c4100101 2e05ae40 20800d21 0260080e 00040400 c0002001 080805c0 90001091 0c40831d 00068801 c0141004 80000200 |