On Target PRGR_HUMAN 0/CHEMBL336736
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL336736. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL336736 (Similar Ligand) |
|---|---|
| C | CC1=CC(C)(C)Nc2ccc3c4cc(F)ccc4O\C(=C/c5ccccc5C)\c3c12 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0408e202 00008809 60100308 02010600 22001005 08004450 82000080 00026400 02000108 20582850 88a48184 70008808 82c08002 00319000 23020043 0208200a 24068400 02409100 0c010000 80c20002 40100008 18020228 302ad000 00c8d010 0104c000 82002280 30402001 500192c9 004ac301 30268002 44040200 20804600 |