On Target PGH2_HUMAN 0/CHEMBL1288469
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1288469. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1288469 (Similar Ligand) |
|---|---|
| C | OC(=O)C1=Cc2cc(C=O)ccc2OC1C(F)(F)F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04800000 00000828 20100309 00011200 00201001 02200000 82240080 01000400 05800004 01100840 40000000 40009000 16828002 00000000 01000003 08082008 00000400 22008000 1141841c 00020001 00040000 08020a00 01008020 02520014 01001000 80000080 00422020 d0000400 00404300 88220001 84000000 00000612 |