On Target TRY1_HUMAN 0/CHEMBL2373367
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL2373367. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL2373367 (Similar Ligand) |
|---|---|
| C | CC(C)(C)OC(=O)CCc1nc(Cc2ccccc2)n(CC(=O)N[C@@H](CCCCN)B3O[C@@H]4C[C@@H]5C[C@@H](C5(C)C)[C@]4(C)O3)n1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000004 01801e08 40101108 00051fc0 01180000 8008c404 90c00000 24003300 00010700 100e08c1 08259008 7203b840 04088003 00800090 00034c00 2018300c 0002c000 c6020001 0ac03018 00a20201 80100421 3846aee8 25000081 07560c1c 00000411 c2000200 40000010 10011080 090c8315 00060013 a2020080 20000f28 |