On Target ACE_HUMAN 0/CHEMBL274550
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL274550. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL274550 (Similar Ligand) |
|---|---|
| C | NCCCCC(NC(=O)C1CCC1)C(=O)NC(Cc2ccccc2)C(=O)CCC(=O)N3CCCC3C(=O)O.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00030000 01007000 00100102 04010600 00080080 00000010 00000000 2000000c 00000880 000808c0 08300000 4001b000 0600801a 01202011 80080000 00080008 10000000 02000000 00402008 00000205 00000100 38240e30 03000001 83500018 00000800 80000000 00000000 90000000 0c000002 00060003 20024000 00802600 |