On Target NTRK1_HUMAN 0/CHEMBL398610
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL398610. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL398610 (Similar Ligand) |
|---|---|
| C | CCOc1cccc2c1c(\C=C\3/C(=O)NN=C3c4snnc4C)cn2C |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04820006 42800c08 29000308 26811694 00041204 40800044 87082281 1104e50a 81804880 c0b828c3 1001000c 44119020 05828806 00604081 01041043 025c204c 20000404 a3a08126 002b8c08 11c60803 c2080802 1a1a8798 6084d028 84400010 034430c0 8c600101 c8606080 50034204 0040024c 000f430a 0c242200 00212160 |