On Target FYN_HUMAN 0/CHEMBL293712
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL293712. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL293712 (Similar Ligand) |
|---|---|
| C | CNS(=O)(=O)c1ccc2NC(=O)\C(=C/c3[nH]c4CCCCc4c3CCCN5CCN(C)CC5)\c2c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 1008421a 0180ea00 01102102 54b10e10 20000339 04012002 91042080 28024409 05c00900 284808d0 0838a104 6080d808 09008082 0031a803 c02201e2 020c010e 2404a600 16000104 0861a408 00806201 c5100100 38308600 21826021 8b410019 00042000 82000201 08402018 508112cc 8c40e406 20a6000b 24002280 30010661 |