On Target ESR1_HUMAN 0/CHEMBL225349
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL225349. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL225349 (Similar Ligand) |
|---|---|
| C | CCn1nc(c2ccc(O)cc2O)c3ccc(O)cc13 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00002005 00000408 a0000100 00010600 010c0000 00002002 06400200 00000000 00000000 000008c1 00010008 60018000 00001036 00c00000 00000000 000c204c 00220000 02800000 04600000 00260a00 00000000 1c010018 11800801 02704008 00100000 80000000 34020000 00000060 0100410c 00060000 00000600 00404020 |