On Target PTGES_HUMAN 0/CHEMBL29097
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL29097. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL29097 (Similar Ligand) |
|---|---|
| C | CC(C)c1ccc2c(c1)c(SC(C)(C)C)c(CC(C)(C)C(=O)O)n2Cc3ccc(Cl)cc3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000900a 01805200 001a1100 12110600 00040221 00000020 00010000 00001000 80100800 104a48c0 08508005 70819800 0e008844 00450000 00030040 020c400c 04000008 06000004 00680018 00010801 c0000100 1c048b18 218000c0 81400419 00007901 c0000000 00050040 00800000 04400004 0087004a 10040340 20030530 |