On Target IKKB_HUMAN 0/CHEMBL249073
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL249073. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL249073 (Similar Ligand) |
|---|---|
| C | CNc1nc2cc(C)sc2n3c(C)cnc13 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0003001a 01002800 00100110 10000230 00100064 0801c000 00408180 00018008 11400100 00001040 01208a04 70090880 80000830 00100000 008e2004 020c0c04 18000000 0200409c 08200011 40a10000 c0000000 4c0880a0 21800880 12400008 0204100a 0d000008 48218400 0000008c 0040080c 00463880 40040000 00c100a0 |