On Target PPARG_HUMAN 0.4698795/CHEMBL207570
For the given ligand Aspirin, we have found in our database that, being scored 0.4698795, the most similar ligand is CHEMBL207570. Check out the elaboration below.
| Aspirin (Given Ligand) | CHEMBL207570 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccccc1C(=O)O | Cc1cc(OCc2cc(cc(c2)c3ccccc3)c4ccccc4)ccc1OCC(=O)O |
|
|
|
|
|
|
| 04000000 00000808 20000108 00010200 00001000 00024000 02000000 00000800 00000100 00000840 00000000 40008020 02808002 00000000 01010001 0008200c 00020000 02008000 00000000 00420000 00000000 08020a20 10000000 00400004 00000000 80000000 00000800 00000001 00000300 00020000 c0004000 10000000 | 04002000 40000008 20000108 00010200 00001001 00004000 02000000 00000000 00010110 00000840 00040000 4000c000 00808002 00010080 01200001 02082008 00020000 82009000 04080000 40020200 00000000 08000a20 14000000 08c01000 00000000 80002000 00080008 00800041 00014300 00020000 40000004 02000000 |