On Target FABP5_HUMAN 0.31004366/CHEMBL3941588
For the given ligand WIN, we have found in our database that, being scored 0.31004366, the most similar ligand is CHEMBL3941588. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL3941588 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | O=C(O)c1c(N2CCCCC2)nc2ccc(Cl)cc2c1-c1ccccc1 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 1801e002 01800801 40104100 00010610 20041004 0001e040 04000000 00100000 00c00100 200008d0 00200004 70019800 8700880e 00600000 20020040 000c000e 00060000 02004004 0c200000 00a00201 c0100000 1c068b68 30800800 8070001c 00042000 80080000 08040280 100010c0 0040c008 00060800 c0041000 01020220 |