On Target PAR1_HUMAN 0.38387096/CHEMBL3086221
For the given ligand WIN, we have found in our database that, being scored 0.38387096, the most similar ligand is CHEMBL3086221. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL3086221 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | Cc1c(C)c(S(=O)(=O)/N=C(/N)NCCC[C@H]2C(=O)N(Cc3ccccc3)C[C@H]([C@H](Cc3cn(C(=O)OC(C)(C)C)c4ccccc34)NC(=O)OC(C)(C)C)N2CC(=O)OC(C)(C)C)c(C)c2c1OC(C)(C)C2 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 1c011012 41c07e08 2110218a c5b10f10 000453c1 0201c000 02002400 2200324c 00f00b00 000999f2 08302004 6003f842 1e809812 02682883 813e14cd 081e211c 1ca30080 e2a8a000 05281c00 00022209 c4000100 382d8eb8 33804023 9b50001c 00042400 c0402003 48800200 912400ed 0c040310 2006081b a01c4210 20013622 |