On Target MK01_HUMAN 0.40186915/CHEMBL1970903
For the given ligand WIN, we have found in our database that, being scored 0.40186915, the most similar ligand is CHEMBL1970903. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL1970903 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | Cc1n[nH]c2ccc(-c3cncc(OCC(N)Cc4c[nH]c5ccccc45)c3)cc12 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 04002002 40000808 60004108 41810712 01041000 0600000e 02082003 00200000 00400900 00090840 08100004 40048000 18800806 08400880 11001040 800c200c 00220040 02000004 04680400 10221203 40000120 1c048008 33800840 81608010 00142401 80080000 08020200 00000040 04404204 00060002 00041200 00004420 |