On Target TRPV3_HUMAN 0.34716982/CHEMBL3696422
For the given ligand WIN, we have found in our database that, being scored 0.34716982, the most similar ligand is CHEMBL3696422. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL3696422 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | CC(C)[C@H](CO)NCc1nc(-c2cc3c(OCc4ccccc4)cccc3n2C(=O)OC(C)(C)C)ccc1F |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 0400629a 00400028 22104188 96010f00 018410a1 00184022 164c0400 02083049 00000540 700c08d0 00250004 40018000 00808836 00691000 01021449 021c010d 12230200 13002026 04e00000 10560207 40100000 18018c38 33800000 a0d01010 00102040 c0002002 00020240 d0041041 0000430c 00260441 60141a00 20244200 |