On Target AMPN_HUMAN 0.41422594/CHEMBL1077583
For the given ligand WIN, we have found in our database that, being scored 0.41422594, the most similar ligand is CHEMBL1077583. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL1077583 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](CN)C(C)C)C(=O)N[C@H]1Cc2c([nH]c3ccccc23)CN(CC(=O)N[C@@H](Cc2ccccc2)C(=O)O)C1=O |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 0001800a 0180fe08 20100100 55810e10 000412a0 00100000 03002000 2200300d 00400880 000909c0 08310004 4001b000 1e008882 0060a801 801204c0 020c010c 10000200 02000006 00600408 00020a01 c0020100 38278e08 23804043 93500018 00143880 c0000001 08124000 90000000 0c000104 0186001b 20044200 00006620 |