On Target CASP1_HUMAN 0.44278607/CHEMBL1221644
For the given ligand WIN, we have found in our database that, being scored 0.44278607, the most similar ligand is CHEMBL1221644. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL1221644 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | Cc1c(CCNC(=O)C[C@H](C(=O)N[C@H](C=O)CC(=O)O)C(C)C)c2ccccc2n1C |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 00070002 01001800 00100100 51010610 00045020 00000000 00002000 20000004 00600080 000908c0 08200004 4003b000 1e008802 00608000 80020040 020c000c 00000200 82800005 00e00410 00000201 40000000 18308e18 21804081 9150001c 00043001 c0000000 08000000 10000000 04000006 00060043 20044200 00802620 |