On Target PDE4B_HUMAN 0.3935185/CHEMBL290191
For the given ligand WIN, we have found in our database that, being scored 0.3935185, the most similar ligand is CHEMBL290191. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL290191 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | COc1ccc(C2CCN(C(=O)c3cc4ccccc4[nH]3)C2)cc1OC1CCCC1 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 04000002 43009a08 20100108 10210f00 000c1020 c2100010 02040000 22003005 00000880 000808c0 08390004 40008000 0080c802 20500080 11020441 020ca10c 00800000 02000006 00680000 00020201 40000100 18278608 21802000 8140001c 00100000 c0000000 00120000 90000000 04000304 0106000b a0040200 00004640 |