On Target ACM4_HUMAN 0.4362745/CHEMBL4080878
For the given ligand WIN, we have found in our database that, being scored 0.4362745, the most similar ligand is CHEMBL4080878. Check out the elaboration below.
| WIN (Given Ligand) | CHEMBL4080878 (Similar Ligand) |
|---|---|
| Cc4c(C(=O)c1cccc2ccccc12)c6cccc5OC[C@@H](CN3CCOCC3)n4c56 | Cc1ccc(OC2CCN(c3c(C#N)cnc4ccc(F)cc34)CC2)cn1 |
|
|
|
|
|
|
| 0c000002 00801c08 60100109 d001061a 000450b0 06008104 0e842401 01200004 00600000 000a08c0 08200004 40058000 00808806 08608000 011a1849 020c610c 10214000 82800004 08a00400 00064200 c0000020 38268618 33804080 8650801c 08042441 e0000000 08120200 50000011 0a040284 40060052 a0044200 00000660 | 04004002 01000008 60104108 12010610 21041020 06002074 008c8001 00200000 00200000 008108c0 00200004 50078000 00800806 08401000 01020040 020c200f 00640000 02000004 08a00000 00220201 40100000 18048008 21800580 82508010 00042401 80000000 08028640 10001081 00408204 00068400 00040000 00000240 |